C8H14O7 — CID 173106065
2-ethoxy-2-hydroxy-3-(hydroxymethyl)-3-methylbutanedioic acid (PubChem CID 173106065) has the molecular formula C8H14O7 and a molecular weight of 222.19 g/mol. Its IUPAC name is 2-ethoxy-2-hydroxy-3-(hydroxymethyl)-3-methylbutanedioic acid.
| Compound Name | 2-ethoxy-2-hydroxy-3-(hydroxymethyl)-3-methylbutanedioic acid |
|---|---|
| PubChem CID | 173106065 |
| Molecular Formula | C8H14O7 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-ethoxy-2-hydroxy-3-(hydroxymethyl)-3-methylbutanedioic acid |
| SMILES | CCOC(O)(C(=O)O)C(C)(CO)C(=O)O |
| InChI | InChI=1S/C8H14O7/c1-3-15-8(14,6(12)13)7(2,4-9)5(10)11/h9,14H,3-4H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | JXPSTTZXLMGBPV-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|