About stannane;sulfanyl 2-butylhexanoate
stannane;sulfanyl 2-butylhexanoate (PubChem CID 173108176) has the molecular formula C10H24O2SSn
and a molecular weight of 327.08 g/mol. Its IUPAC name is stannane;sulfanyl 2-butylhexanoate.
Molecular Properties
| Compound Name | stannane;sulfanyl 2-butylhexanoate |
| PubChem CID | 173108176 |
| Molecular Formula | C10H24O2SSn |
| Molecular Weight | 327.08 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | stannane;sulfanyl 2-butylhexanoate |
| SMILES | CCCCC(CCCC)C(=O)OS.[SnH4] |
| InChI | InChI=1S/C10H20O2S.Sn.4H/c1-3-5-7-9(8-6-4-2)10(11)12-13;;;;;/h9,13H,3-8H2,1-2H3;;;;; |
| InChIKey | ZICVTSPWKRNRGP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.08 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze stannane;sulfanyl 2-butylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of stannane;sulfanyl 2-butylhexanoate?
The IUPAC name of stannane;sulfanyl 2-butylhexanoate (CID 173108176) is stannane;sulfanyl 2-butylhexanoate.
What is the SMILES notation for stannane;sulfanyl 2-butylhexanoate?
The canonical SMILES for stannane;sulfanyl 2-butylhexanoate is CCCCC(CCCC)C(=O)OS.[SnH4].
What is the InChIKey of stannane;sulfanyl 2-butylhexanoate?
The InChIKey is ZICVTSPWKRNRGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S.Sn.4H/c1-3-5-7-9(8-6-4-2)10(11)12-13;;;;;/h9,13H,3-8H2,1-2H3;;;;;.
What are the key properties of stannane;sulfanyl 2-butylhexanoate?
stannane;sulfanyl 2-butylhexanoate has a molecular weight of 327.08 g/mol, XLogP of 1.92, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for stannane;sulfanyl 2-butylhexanoate is sourced from PubChem (CID 173108176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).