C26H21N5O3 — CID 173108699
2-amino-N-[2-[2-(3-nitrophenyl)-9H-pyrido[2,3-b]indol-6-yl]ethyl]benzamide (PubChem CID 173108699) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 2-amino-N-[2-[2-(3-nitrophenyl)-9H-pyrido[2,3-b]indol-6-yl]ethyl]benzamide.
| Compound Name | 2-amino-N-[2-[2-(3-nitrophenyl)-9H-pyrido[2,3-b]indol-6-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 173108699 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-amino-N-[2-[2-(3-nitrophenyl)-9H-pyrido[2,3-b]indol-6-yl]ethyl]benzamide |
| SMILES | Nc1ccccc1C(=O)NCCc1ccc2[nH]c3nc(-c4cccc([N+](=O)[O-])c4)ccc3c2c1 |
| InChI | InChI=1S/C26H21N5O3/c27-22-7-2-1-6-20(22)26(32)28-13-12-16-8-10-24-21(14-16)19-9-11-23(29-25(19)30-24)17-4-3-5-18(15-17)31(33)34/h1-11,14-15H,12-13,27H2,(H,28,32)(H,29,30) |
| InChIKey | KEZPAJWJSZXKLA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|