C16H24ClN3O2 — CID 173109798
N'-[4-(3-chloro-2-methoxyiminopropoxy)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 173109798) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is N'-[4-(3-chloro-2-methoxyiminopropoxy)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(3-chloro-2-methoxyiminopropoxy)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 173109798 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N'-[4-(3-chloro-2-methoxyiminopropoxy)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(OCC(CCl)=NOC)cc1C |
| InChI | InChI=1S/C16H24ClN3O2/c1-6-20(4)11-18-15-7-13(3)16(8-12(15)2)22-10-14(9-17)19-21-5/h7-8,11H,6,9-10H2,1-5H3/b18-11+,19-14? |
| InChIKey | UGCCWVLFBFAWTL-QEYQCYAISA-N |
| XLogP | 3.53 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|