C14H19N3O2 — CID 173109987
N-ethyl-N'-phenyl-N'-pyrrolidin-1-yloxamide (PubChem CID 173109987) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-ethyl-N'-phenyl-N'-pyrrolidin-1-yloxamide.
| Compound Name | N-ethyl-N'-phenyl-N'-pyrrolidin-1-yloxamide |
|---|---|
| PubChem CID | 173109987 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-ethyl-N'-phenyl-N'-pyrrolidin-1-yloxamide |
| SMILES | CCNC(=O)C(=O)N(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C14H19N3O2/c1-2-15-13(18)14(19)17(16-10-6-7-11-16)12-8-4-3-5-9-12/h3-5,8-9H,2,6-7,10-11H2,1H3,(H,15,18) |
| InChIKey | MMTBDRAWXSGDIP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|