C15H24N6 — CID 174723354
2-(N'-ethylcarbamimidoyl)-1-phenyl-1-piperidin-1-ylguanidine (PubChem CID 174723354) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-(N'-ethylcarbamimidoyl)-1-phenyl-1-piperidin-1-ylguanidine.
| Compound Name | 2-(N'-ethylcarbamimidoyl)-1-phenyl-1-piperidin-1-ylguanidine |
|---|---|
| PubChem CID | 174723354 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-(N'-ethylcarbamimidoyl)-1-phenyl-1-piperidin-1-ylguanidine |
| SMILES | CC/N=C(\N)N=C(N)N(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C15H24N6/c1-2-18-14(16)19-15(17)21(13-9-5-3-6-10-13)20-11-7-4-8-12-20/h3,5-6,9-10H,2,4,7-8,11-12H2,1H3,(H4,16,17,18,19) |
| InChIKey | IXLNBFHSPDKHQA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|