C8H20ClN5 — CID 86583244
1,1-diethyl-2-(N'-ethylcarbamimidoyl)guanidine;hydrochloride (PubChem CID 86583244) has the molecular formula C8H20ClN5 and a molecular weight of 221.74 g/mol. Its IUPAC name is 1,1-diethyl-2-(N'-ethylcarbamimidoyl)guanidine;hydrochloride.
| Compound Name | 1,1-diethyl-2-(N'-ethylcarbamimidoyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 86583244 |
| Molecular Formula | C8H20ClN5 |
| Molecular Weight | 221.74 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1,1-diethyl-2-(N'-ethylcarbamimidoyl)guanidine;hydrochloride |
| SMILES | CC/N=C(N)/N=C(\N)N(CC)CC.Cl |
| InChI | InChI=1S/C8H19N5.ClH/c1-4-11-7(9)12-8(10)13(5-2)6-3;/h4-6H2,1-3H3,(H4,9,10,11,12);1H |
| InChIKey | KGRQPUQHBVLOIX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.74 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|