C3H5NO5S — CID 173112516
hydrogen sulfate;hydron;1,3-oxazole (PubChem CID 173112516) has the molecular formula C3H5NO5S and a molecular weight of 167.14 g/mol. Its IUPAC name is hydrogen sulfate;hydron;1,3-oxazole.
| Compound Name | hydrogen sulfate;hydron;1,3-oxazole |
|---|---|
| PubChem CID | 173112516 |
| Molecular Formula | C3H5NO5S |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 166.99 |
| IUPAC Name | hydrogen sulfate;hydron;1,3-oxazole |
| SMILES | O=S(=O)([O-])O.[H+].c1cocn1 |
| InChI | InChI=1S/C3H3NO.H2O4S/c1-2-5-3-4-1;1-5(2,3)4/h1-3H;(H2,1,2,3,4) |
| InChIKey | JFVQTBCQTKUHQV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|