C12H13NO4S3 — CID 173115537
3-(1,1-dihydroxythiolan-3-yl)-5-(furan-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 173115537) has the molecular formula C12H13NO4S3 and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-(1,1-dihydroxythiolan-3-yl)-5-(furan-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,1-dihydroxythiolan-3-yl)-5-(furan-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 173115537 |
| Molecular Formula | C12H13NO4S3 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 3-(1,1-dihydroxythiolan-3-yl)-5-(furan-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccco2)SC(=S)N1C1CCS(O)(O)C1 |
| InChI | InChI=1S/C12H13NO4S3/c14-11-10(6-9-2-1-4-17-9)19-12(18)13(11)8-3-5-20(15,16)7-8/h1-2,4,6,8,15-16H,3,5,7H2 |
| InChIKey | QGUBGXXQJJHUAR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|