C17H20N2O5S3 — CID 92945920
(2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanamide (PubChem CID 92945920) has the molecular formula C17H20N2O5S3 and a molecular weight of 428.56 g/mol. Its IUPAC name is (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanamide.
| Compound Name | (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 92945920 |
| Molecular Formula | C17H20N2O5S3 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | (2R)-N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)N[C@@H]1CCS(=O)(=O)C1)N1C(=O)/C(=C/c2ccco2)SC1=S |
| InChI | InChI=1S/C17H20N2O5S3/c1-10(2)14(15(20)18-11-5-7-27(22,23)9-11)19-16(21)13(26-17(19)25)8-12-4-3-6-24-12/h3-4,6,8,10-11,14H,5,7,9H2,1-2H3,(H,18,20)/b13-8-/t11-,14-/m1/s1 |
| InChIKey | ALZLXONBPZZPIW-TVGBFMDESA-N |
| XLogP | 1.81 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|