C12H30N2O5S — CID 173120676
ethoxyethane;hydrogen sulfate;trimethyl-[1-(prop-2-enylamino)ethyl]azanium (PubChem CID 173120676) has the molecular formula C12H30N2O5S and a molecular weight of 314.45 g/mol. Its IUPAC name is ethoxyethane;hydrogen sulfate;trimethyl-[1-(prop-2-enylamino)ethyl]azanium.
| Compound Name | ethoxyethane;hydrogen sulfate;trimethyl-[1-(prop-2-enylamino)ethyl]azanium |
|---|---|
| PubChem CID | 173120676 |
| Molecular Formula | C12H30N2O5S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | ethoxyethane;hydrogen sulfate;trimethyl-[1-(prop-2-enylamino)ethyl]azanium |
| SMILES | C=CCNC(C)[N+](C)(C)C.CCOCC.O=S(=O)([O-])O |
| InChI | InChI=1S/C8H19N2.C4H10O.H2O4S/c1-6-7-9-8(2)10(3,4)5;1-3-5-4-2;1-5(2,3)4/h6,8-9H,1,7H2,2-5H3;3-4H2,1-2H3;(H2,1,2,3,4)/q+1;;/p-1 |
| InChIKey | HTYQMHAXIXQMMH-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|