C14H17IO3 — CID 173120788
3-hydroxy-2-(iodomethylidene)-3-(4-methylphenyl)hexanoic acid (PubChem CID 173120788) has the molecular formula C14H17IO3 and a molecular weight of 360.19 g/mol. Its IUPAC name is 3-hydroxy-2-(iodomethylidene)-3-(4-methylphenyl)hexanoic acid.
| Compound Name | 3-hydroxy-2-(iodomethylidene)-3-(4-methylphenyl)hexanoic acid |
|---|---|
| PubChem CID | 173120788 |
| Molecular Formula | C14H17IO3 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 3-hydroxy-2-(iodomethylidene)-3-(4-methylphenyl)hexanoic acid |
| SMILES | CCCC(O)(C(=CI)C(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H17IO3/c1-3-8-14(18,12(9-15)13(16)17)11-6-4-10(2)5-7-11/h4-7,9,18H,3,8H2,1-2H3,(H,16,17) |
| InChIKey | WFSNTPDGKQDWEL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|