C19H18N2O3 — CID 173121595
(3aR,7R,7aS)-2-isoquinolin-5-yl-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 173121595) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (3aR,7R,7aS)-2-isoquinolin-5-yl-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,7R,7aS)-2-isoquinolin-5-yl-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 173121595 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (3aR,7R,7aS)-2-isoquinolin-5-yl-4,7-dimethyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CC12CC[C@@](C)(O1)[C@H]1C(=O)N(c3cccc4cnccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H18N2O3/c1-18-7-8-19(2,24-18)15-14(18)16(22)21(17(15)23)13-5-3-4-11-10-20-9-6-12(11)13/h3-6,9-10,14-15H,7-8H2,1-2H3/t14-,15+,18-,19?/m1/s1 |
| InChIKey | AQDLEPKUXKBWET-COFIIOCFSA-N |
| XLogP | 2.68 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|