dihydroxy(dioxo)tungsten;phosphoric acid

H5O8PW — CID 173124122

IUPACdihydroxy(dioxo)tungsten;phosphoric acid
SMILESO=P(O)(O)O.O=[W](=O)(O)O
InChIInChI=1S/H3O4P.2H2O.2O.W/c1-5(2,3)4;;;;;/h(H3,1,2,3,4);2*1H2;;;/q;;;;;+2/p-2
InChIKeyBIGFAJKXHNFZHH-UHFFFAOYSA-L
MW347.85 g/mol
LogP-2.28
Rot. Bonds

About dihydroxy(dioxo)tungsten;phosphoric acid

dihydroxy(dioxo)tungsten;phosphoric acid (PubChem CID 173124122) has the molecular formula H5O8PW and a molecular weight of 347.85 g/mol. Its IUPAC name is dihydroxy(dioxo)tungsten;phosphoric acid.

Molecular Properties

Compound Namedihydroxy(dioxo)tungsten;phosphoric acid
PubChem CID173124122
Molecular FormulaH5O8PW
Molecular Weight347.85 g/mol
Exact Mass347.92
IUPAC Namedihydroxy(dioxo)tungsten;phosphoric acid
SMILESO=P(O)(O)O.O=[W](=O)(O)O
InChIInChI=1S/H3O4P.2H2O.2O.W/c1-5(2,3)4;;;;;/h(H3,1,2,3,4);2*1H2;;;/q;;;;;+2/p-2
InChIKeyBIGFAJKXHNFZHH-UHFFFAOYSA-L
XLogP-2.28
TPSA152.36 Ų
H-Bond Donors5
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.85
LogP ≤ 5-2.28
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze dihydroxy(dioxo)tungsten;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

dihydroxy(dioxo)tungsten;nickel
CID 177417803
calcium dihydroxy(dioxo)tungsten
CID 170924091
methane;phosphoric acid
CID 18515646
phosphoric acid;hydrate
CID 22023151
phosphane;phosphoric acid
CID 172840180
CID 159816390
CID 159816390
hydrogen peroxide;phosphoric acid
CID 18509931
iron;phosphoric acid
CID 174838016
cerium;phosphoric acid
CID 90659592
CID 173050648
CID 173050648
methane;phosphoric acid
CID 173400304
phosphane;phosphoric acid
CID 173160232

Frequently Asked Questions

What is the IUPAC name of dihydroxy(dioxo)tungsten;phosphoric acid?
The IUPAC name of dihydroxy(dioxo)tungsten;phosphoric acid (CID 173124122) is dihydroxy(dioxo)tungsten;phosphoric acid.
What is the SMILES notation for dihydroxy(dioxo)tungsten;phosphoric acid?
The canonical SMILES for dihydroxy(dioxo)tungsten;phosphoric acid is O=P(O)(O)O.O=[W](=O)(O)O.
What is the InChIKey of dihydroxy(dioxo)tungsten;phosphoric acid?
The InChIKey is BIGFAJKXHNFZHH-UHFFFAOYSA-L. The full InChI is InChI=1S/H3O4P.2H2O.2O.W/c1-5(2,3)4;;;;;/h(H3,1,2,3,4);2*1H2;;;/q;;;;;+2/p-2.
What are the key properties of dihydroxy(dioxo)tungsten;phosphoric acid?
dihydroxy(dioxo)tungsten;phosphoric acid has a molecular weight of 347.85 g/mol, XLogP of -2.28, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(dioxo)tungsten;phosphoric acid is sourced from PubChem (CID 173124122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).