C20H29Cl2N2O6+ — CID 173128109
[(3S)-1-(cyclopropylmethyl)-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine;2,3-dihydroxybutanedioic acid (PubChem CID 173128109) has the molecular formula C20H29Cl2N2O6+ and a molecular weight of 464.37 g/mol. Its IUPAC name is [(3S)-1-(cyclopropylmethyl)-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine;2,3-dihydroxybutanedioic acid.
| Compound Name | [(3S)-1-(cyclopropylmethyl)-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 173128109 |
| Molecular Formula | C20H29Cl2N2O6+ |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [(3S)-1-(cyclopropylmethyl)-1-[(2,4-dichlorophenyl)methyl]pyrrolidin-1-ium-3-yl]methanamine;2,3-dihydroxybutanedioic acid |
| SMILES | NC[C@@H]1CC[N+](Cc2ccc(Cl)cc2Cl)(CC2CC2)C1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C16H23Cl2N2.C4H6O6/c17-15-4-3-14(16(18)7-15)11-20(9-12-1-2-12)6-5-13(8-19)10-20;5-1(3(7)8)2(6)4(9)10/h3-4,7,12-13H,1-2,5-6,8-11,19H2;1-2,5-6H,(H,7,8)(H,9,10)/q+1;/t13-,20?;/m0./s1 |
| InChIKey | DGTCJNFJZSMWPW-MZEXVYEGSA-N |
| XLogP | 1.58 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|