C11H22O4 — CID 173128397
4,6,6-trimethoxy-4-methylheptan-2-one (PubChem CID 173128397) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 4,6,6-trimethoxy-4-methylheptan-2-one.
| Compound Name | 4,6,6-trimethoxy-4-methylheptan-2-one |
|---|---|
| PubChem CID | 173128397 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4,6,6-trimethoxy-4-methylheptan-2-one |
| SMILES | COC(C)(CC(C)=O)CC(C)(OC)OC |
| InChI | InChI=1S/C11H22O4/c1-9(12)7-10(2,13-4)8-11(3,14-5)15-6/h7-8H2,1-6H3 |
| InChIKey | RYPDRTIHJQDUAZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|