C10H10F3NO7S — CID 173129515
(8,9-dihydroxy-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl) trifluoromethanesulfonate (PubChem CID 173129515) has the molecular formula C10H10F3NO7S and a molecular weight of 345.25 g/mol. Its IUPAC name is (8,9-dihydroxy-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl) trifluoromethanesulfonate.
| Compound Name | (8,9-dihydroxy-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 173129515 |
| Molecular Formula | C10H10F3NO7S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | (8,9-dihydroxy-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl) trifluoromethanesulfonate |
| SMILES | O=C1C2C3CC(C(O)C3O)C2C(=O)N1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO7S/c11-10(12,13)22(19,20)21-14-8(17)4-2-1-3(5(4)9(14)18)7(16)6(2)15/h2-7,15-16H,1H2 |
| InChIKey | CZRLHMNENZNZKZ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|