C10H13NO4Y-2 — CID 159510694
carbanide;8,9-dihydroxy-4-azanidatricyclo[5.2.1.02,6]decane-3,5-dione;yttrium (PubChem CID 159510694) has the molecular formula C10H13NO4Y-2 and a molecular weight of 300.12 g/mol. Its IUPAC name is carbanide;8,9-dihydroxy-4-azanidatricyclo[5.2.1.02,6]decane-3,5-dione;yttrium.
| Compound Name | carbanide;8,9-dihydroxy-4-azanidatricyclo[5.2.1.02,6]decane-3,5-dione;yttrium |
|---|---|
| PubChem CID | 159510694 |
| Molecular Formula | C10H13NO4Y-2 |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | carbanide;8,9-dihydroxy-4-azanidatricyclo[5.2.1.02,6]decane-3,5-dione;yttrium |
| SMILES | O=C1[N-]C(=O)C2C3CC(C(O)C3O)C12.[CH3-].[Y] |
| InChI | InChI=1S/C9H11NO4.CH3.Y/c11-6-2-1-3(7(6)12)5-4(2)8(13)10-9(5)14;;/h2-7,11-12H,1H2,(H,10,13,14);1H3;/q;-1;/p-1 |
| InChIKey | AYBMBTRYZDXMLD-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|