C9H11NO3 — CID 59293608
(1S,2R,6S,7R,8S)-8-hydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 59293608) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-8-hydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S)-8-hydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 59293608 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (1S,2R,6S,7R,8S)-8-hydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1NC(=O)[C@H]2[C@H]3C[C@@H](C[C@@H]3O)[C@@H]12 |
| InChI | InChI=1S/C9H11NO3/c11-5-2-3-1-4(5)7-6(3)8(12)10-9(7)13/h3-7,11H,1-2H2,(H,10,12,13)/t3-,4-,5-,6+,7-/m0/s1 |
| InChIKey | VRZSELGAZLWBBO-ZVPSTABDSA-N |
| XLogP | -0.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|