C9H9NO3 — CID 58279951
(8S)-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (PubChem CID 58279951) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is (8S)-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione.
| Compound Name | (8S)-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
|---|---|
| PubChem CID | 58279951 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (8S)-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| SMILES | O=C1NC(=O)C2C1C1CC2[C@@H]2OC12 |
| InChI | InChI=1S/C9H9NO3/c11-8-4-2-1-3(7-6(2)13-7)5(4)9(12)10-8/h2-7H,1H2,(H,10,11,12)/t2?,3?,4?,5?,6-,7?/m0/s1 |
| InChIKey | UJXPPCDJYRWSLC-HVPTUZHTSA-N |
| XLogP | -0.71 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|