C13H15NO6Y-2 — CID 58843019
ethanone;(9-hydroxy-3,5-dioxo-4-azanidatricyclo[5.2.1.02,6]decan-8-yl) acetate;yttrium (PubChem CID 58843019) has the molecular formula C13H15NO6Y-2 and a molecular weight of 370.17 g/mol. Its IUPAC name is ethanone;(9-hydroxy-3,5-dioxo-4-azanidatricyclo[5.2.1.02,6]decan-8-yl) acetate;yttrium.
| Compound Name | ethanone;(9-hydroxy-3,5-dioxo-4-azanidatricyclo[5.2.1.02,6]decan-8-yl) acetate;yttrium |
|---|---|
| PubChem CID | 58843019 |
| Molecular Formula | C13H15NO6Y-2 |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | ethanone;(9-hydroxy-3,5-dioxo-4-azanidatricyclo[5.2.1.02,6]decan-8-yl) acetate;yttrium |
| SMILES | CC(=O)OC1C(O)C2CC1C1C(=O)[N-]C(=O)C21.C[C-]=O.[Y] |
| InChI | InChI=1S/C11H13NO5.C2H3O.Y/c1-3(13)17-9-5-2-4(8(9)14)6-7(5)11(16)12-10(6)15;1-2-3;/h4-9,14H,2H2,1H3,(H,12,15,16);1H3;/q;-1;/p-1 |
| InChIKey | RCUUSNXYAVHPOD-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|