C26H29N2NaO5 — CID 173129608
sodium;hydride;N-[(2S)-3-[4-(hydroxymethoxy)phenyl]-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxopropan-2-yl]benzamide (PubChem CID 173129608) has the molecular formula C26H29N2NaO5 and a molecular weight of 472.52 g/mol. Its IUPAC name is sodium;hydride;N-[(2S)-3-[4-(hydroxymethoxy)phenyl]-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | sodium;hydride;N-[(2S)-3-[4-(hydroxymethoxy)phenyl]-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 173129608 |
| Molecular Formula | C26H29N2NaO5 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | sodium;hydride;N-[(2S)-3-[4-(hydroxymethoxy)phenyl]-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-1-oxopropan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](Cc1ccc(OCO)cc1)C(=O)N[C@H](CO)Cc1ccccc1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C26H28N2O5.Na.H/c29-17-22(15-19-7-3-1-4-8-19)27-26(32)24(28-25(31)21-9-5-2-6-10-21)16-20-11-13-23(14-12-20)33-18-30;;/h1-14,22,24,29-30H,15-18H2,(H,27,32)(H,28,31);;/q;+1;-1/t22-,24-;;/m0../s1 |
| InChIKey | HWZDOOBRFMMSEN-SBKRINIZSA-N |
| XLogP | -0.81 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|