C27H28N2O5 — CID 70965829
methyl (3S)-3-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-4-(4-hydroxyphenyl)butanoate (PubChem CID 70965829) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is methyl (3S)-3-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-4-(4-hydroxyphenyl)butanoate.
| Compound Name | methyl (3S)-3-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-4-(4-hydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 70965829 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | methyl (3S)-3-[[(2S)-2-benzamido-3-phenylpropanoyl]amino]-4-(4-hydroxyphenyl)butanoate |
| SMILES | COC(=O)C[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O5/c1-34-25(31)18-22(16-20-12-14-23(30)15-13-20)28-27(33)24(17-19-8-4-2-5-9-19)29-26(32)21-10-6-3-7-11-21/h2-15,22,24,30H,16-18H2,1H3,(H,28,33)(H,29,32)/t22-,24-/m0/s1 |
| InChIKey | WPYYVBRCLBAKLS-UPVQGACJSA-N |
| XLogP | 3.02 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |