C12H21NO3Si — CID 173133696
N,N,3-trimethoxy-3-phenyl-3-silylpropan-1-amine (PubChem CID 173133696) has the molecular formula C12H21NO3Si and a molecular weight of 255.39 g/mol. Its IUPAC name is N,N,3-trimethoxy-3-phenyl-3-silylpropan-1-amine.
| Compound Name | N,N,3-trimethoxy-3-phenyl-3-silylpropan-1-amine |
|---|---|
| PubChem CID | 173133696 |
| Molecular Formula | C12H21NO3Si |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N,N,3-trimethoxy-3-phenyl-3-silylpropan-1-amine |
| SMILES | CON(CCC([SiH3])(OC)c1ccccc1)OC |
| InChI | InChI=1S/C12H21NO3Si/c1-14-12(17,9-10-13(15-2)16-3)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3,17H3 |
| InChIKey | KOADUICXFSWLKO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|