C39H42Zr — CID 173138234
1-[(3,5-dimethylcyclopenta-1,4-dien-1-yl)methyl]adamantane;9H-fluoren-9-ide;(4-methylphenyl)methylidenezirconium(2+) (PubChem CID 173138234) has the molecular formula C39H42Zr and a molecular weight of 601.99 g/mol. Its IUPAC name is 1-[(3,5-dimethylcyclopenta-1,4-dien-1-yl)methyl]adamantane;9H-fluoren-9-ide;(4-methylphenyl)methylidenezirconium(2+).
| Compound Name | 1-[(3,5-dimethylcyclopenta-1,4-dien-1-yl)methyl]adamantane;9H-fluoren-9-ide;(4-methylphenyl)methylidenezirconium(2+) |
|---|---|
| PubChem CID | 173138234 |
| Molecular Formula | C39H42Zr |
| Molecular Weight | 601.99 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 1-[(3,5-dimethylcyclopenta-1,4-dien-1-yl)methyl]adamantane;9H-fluoren-9-ide;(4-methylphenyl)methylidenezirconium(2+) |
| SMILES | CC1=[C-]C(C)C=C1CC12CC3CC(CC(C3)C1)C2.Cc1ccc(C=[Zr+2])cc1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C18H25.C13H9.C8H8.Zr/c1-12-3-13(2)17(4-12)11-18-8-14-5-15(9-18)7-16(6-14)10-18;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-7-3-5-8(2)6-4-7;/h4,12,14-16H,5-11H2,1-2H3;1-9H;1,3-6H,2H3;/q2*-1;;+2 |
| InChIKey | ZGJBFCIOAIHHIX-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.99 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|