C37H44Zr — CID 173138325
2,7-ditert-butyl-9H-fluoren-9-ide;(4-methylphenyl)methylidenezirconium(2+);2,3,5-trimethylcyclopenta-1,3-diene (PubChem CID 173138325) has the molecular formula C37H44Zr and a molecular weight of 579.98 g/mol. Its IUPAC name is 2,7-ditert-butyl-9H-fluoren-9-ide;(4-methylphenyl)methylidenezirconium(2+);2,3,5-trimethylcyclopenta-1,3-diene.
| Compound Name | 2,7-ditert-butyl-9H-fluoren-9-ide;(4-methylphenyl)methylidenezirconium(2+);2,3,5-trimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 173138325 |
| Molecular Formula | C37H44Zr |
| Molecular Weight | 579.98 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 2,7-ditert-butyl-9H-fluoren-9-ide;(4-methylphenyl)methylidenezirconium(2+);2,3,5-trimethylcyclopenta-1,3-diene |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1cc(C(C)(C)C)ccc12.CC1=[C-]C(C)C=C1C.Cc1ccc(C=[Zr+2])cc1 |
| InChI | InChI=1S/C21H25.C8H11.C8H8.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-6-4-7(2)8(3)5-6;1-7-3-5-8(2)6-4-7;/h7-13H,1-6H3;4,6H,1-3H3;1,3-6H,2H3;/q2*-1;;+2 |
| InChIKey | BCEOYNHTNHZAQA-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.98 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|