C45H52Cl2SiZr-2 — CID 87694095
bis[(4-chlorophenyl)methylidene]zirconium;2,7-ditert-butyl-9H-fluoren-9-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)-trimethylsilane (PubChem CID 87694095) has the molecular formula C45H52Cl2SiZr-2 and a molecular weight of 783.13 g/mol. Its IUPAC name is bis[(4-chlorophenyl)methylidene]zirconium;2,7-ditert-butyl-9H-fluoren-9-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)-trimethylsilane.
| Compound Name | bis[(4-chlorophenyl)methylidene]zirconium;2,7-ditert-butyl-9H-fluoren-9-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 87694095 |
| Molecular Formula | C45H52Cl2SiZr-2 |
| Molecular Weight | 783.13 g/mol |
| Exact Mass | 780.23 |
| IUPAC Name | bis[(4-chlorophenyl)methylidene]zirconium;2,7-ditert-butyl-9H-fluoren-9-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)-trimethylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1cc(C(C)(C)C)ccc12.CC1=[C-]C(C)C=C1[Si](C)(C)C.Clc1ccc(C=[Zr]=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H25.C10H17Si.2C7H5Cl.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-8-6-9(2)10(7-8)11(3,4)5;2*1-6-2-4-7(8)5-3-6;/h7-13H,1-6H3;7-8H,1-5H3;2*1-5H;/q2*-1;;; |
| InChIKey | QWQZHBNJXZRKJN-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.13 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|