C34H48SiZr — CID 173086088
2,7-ditert-butyl-9H-fluoren-9-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)-trimethylsilane;propan-2-ylidenezirconium(2+) (PubChem CID 173086088) has the molecular formula C34H48SiZr and a molecular weight of 576.07 g/mol. Its IUPAC name is 2,7-ditert-butyl-9H-fluoren-9-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)-trimethylsilane;propan-2-ylidenezirconium(2+).
| Compound Name | 2,7-ditert-butyl-9H-fluoren-9-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)-trimethylsilane;propan-2-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 173086088 |
| Molecular Formula | C34H48SiZr |
| Molecular Weight | 576.07 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2,7-ditert-butyl-9H-fluoren-9-ide;(3,5-dimethylcyclopenta-1,4-dien-1-yl)-trimethylsilane;propan-2-ylidenezirconium(2+) |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1cc(C(C)(C)C)ccc12.CC(C)=[Zr+2].CC1=[C-]C(C)C=C1[Si](C)(C)C |
| InChI | InChI=1S/C21H25.C10H17Si.C3H6.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-8-6-9(2)10(7-8)11(3,4)5;1-3-2;/h7-13H,1-6H3;7-8H,1-5H3;1-2H3;/q2*-1;;+2 |
| InChIKey | MHLDCQMEUCHLHN-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.07 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|