C11H18O6Si — CID 173141328
4-O-(2,3-dimethyl-4-oxo-4-silyloxybutan-2-yl) 1-O-methyl (Z)-but-2-enedioate (PubChem CID 173141328) has the molecular formula C11H18O6Si and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-O-(2,3-dimethyl-4-oxo-4-silyloxybutan-2-yl) 1-O-methyl (Z)-but-2-enedioate.
| Compound Name | 4-O-(2,3-dimethyl-4-oxo-4-silyloxybutan-2-yl) 1-O-methyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 173141328 |
| Molecular Formula | C11H18O6Si |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-O-(2,3-dimethyl-4-oxo-4-silyloxybutan-2-yl) 1-O-methyl (Z)-but-2-enedioate |
| SMILES | COC(=O)/C=C\C(=O)OC(C)(C)C(C)C(=O)O[SiH3] |
| InChI | InChI=1S/C11H18O6Si/c1-7(10(14)17-18)11(2,3)16-9(13)6-5-8(12)15-4/h5-7H,1-4,18H3/b6-5- |
| InChIKey | SSWUMFNTRIKZLH-WAYWQWQTSA-N |
| XLogP | -0.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|