C20H36O4 — CID 88826242
bis(2,3,4-trimethylpentan-2-yl) (Z)-but-2-enedioate (PubChem CID 88826242) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is bis(2,3,4-trimethylpentan-2-yl) (Z)-but-2-enedioate.
| Compound Name | bis(2,3,4-trimethylpentan-2-yl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 88826242 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | bis(2,3,4-trimethylpentan-2-yl) (Z)-but-2-enedioate |
| SMILES | CC(C)C(C)C(C)(C)OC(=O)/C=C\C(=O)OC(C)(C)C(C)C(C)C |
| InChI | InChI=1S/C20H36O4/c1-13(2)15(5)19(7,8)23-17(21)11-12-18(22)24-20(9,10)16(6)14(3)4/h11-16H,1-10H3/b12-11- |
| InChIKey | VJKJYAQBBZDTHM-QXMHVHEDSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|