C28H21FN3NaO3S — CID 173142408
sodium;acetic acid;(5E)-2-(3-fluorobenzene-4-id-1-yl)imino-5-[[4-(4-pyrrol-1-ylphenyl)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 173142408) has the molecular formula C28H21FN3NaO3S and a molecular weight of 521.55 g/mol. Its IUPAC name is sodium;acetic acid;(5E)-2-(3-fluorobenzene-4-id-1-yl)imino-5-[[4-(4-pyrrol-1-ylphenyl)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | sodium;acetic acid;(5E)-2-(3-fluorobenzene-4-id-1-yl)imino-5-[[4-(4-pyrrol-1-ylphenyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 173142408 |
| Molecular Formula | C28H21FN3NaO3S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | sodium;acetic acid;(5E)-2-(3-fluorobenzene-4-id-1-yl)imino-5-[[4-(4-pyrrol-1-ylphenyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(=O)O.O=C1N/C(=N/c2cc[c-]c(F)c2)S/C1=C/c1ccc(-c2ccc(-n3cccc3)cc2)cc1.[Na+] |
| InChI | InChI=1S/C26H17FN3OS.C2H4O2.Na/c27-21-4-3-5-22(17-21)28-26-29-25(31)24(32-26)16-18-6-8-19(9-7-18)20-10-12-23(13-11-20)30-14-1-2-15-30;1-2(3)4;/h1-3,5-17H,(H,28,29,31);1H3,(H,3,4);/q-1;;+1/b24-16+;; |
| InChIKey | AGSLGFBTIYZOPW-OAITZSNASA-N |
| XLogP | 3.07 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|