C25H20FN2NaO4S — CID 159073076
sodium;acetic acid;5-[[4-(3-fluoro-4-methoxyphenyl)phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 159073076) has the molecular formula C25H20FN2NaO4S and a molecular weight of 486.50 g/mol. Its IUPAC name is sodium;acetic acid;5-[[4-(3-fluoro-4-methoxyphenyl)phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | sodium;acetic acid;5-[[4-(3-fluoro-4-methoxyphenyl)phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 159073076 |
| Molecular Formula | C25H20FN2NaO4S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | sodium;acetic acid;5-[[4-(3-fluoro-4-methoxyphenyl)phenyl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CC(=O)O.COc1ccc(-c2ccc(C=C3S/C(=N\c4cc[c-]cc4)NC3=O)cc2)cc1F.[Na+] |
| InChI | InChI=1S/C23H16FN2O2S.C2H4O2.Na/c1-28-20-12-11-17(14-19(20)24)16-9-7-15(8-10-16)13-21-22(27)26-23(29-21)25-18-5-3-2-4-6-18;1-2(3)4;/h3-14H,1H3,(H,25,26,27);1H3,(H,3,4);/q-1;;+1 |
| InChIKey | ABQZSUNAPCURJJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|