C20H22N4O4 — CID 173143047
1-acetyl-4-N-[4-(2-oxo-1-pyridinyl)phenyl]piperidine-2,4-dicarboxamide (PubChem CID 173143047) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-acetyl-4-N-[4-(2-oxo-1-pyridinyl)phenyl]piperidine-2,4-dicarboxamide.
| Compound Name | 1-acetyl-4-N-[4-(2-oxo-1-pyridinyl)phenyl]piperidine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 173143047 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-acetyl-4-N-[4-(2-oxo-1-pyridinyl)phenyl]piperidine-2,4-dicarboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2ccc(-n3ccccc3=O)cc2)CC1C(N)=O |
| InChI | InChI=1S/C20H22N4O4/c1-13(25)23-11-9-14(12-17(23)19(21)27)20(28)22-15-5-7-16(8-6-15)24-10-3-2-4-18(24)26/h2-8,10,14,17H,9,11-12H2,1H3,(H2,21,27)(H,22,28) |
| InChIKey | SZFPNLIMERLWMK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |