molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide

C12H12N2O2 — CID 143214195

IUPACmolecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide
SMILESNC(=O)c1ccc(-n2ccccc2=O)cc1.[H][H]
InChIInChI=1S/C12H10N2O2.H2/c13-12(16)9-4-6-10(7-5-9)14-8-2-1-3-11(14)15;/h1-8H,(H2,13,16);1H
InChIKeyQVFUGUNIJHWPRC-UHFFFAOYSA-N
MW216.24 g/mol
LogP1.18
Rot. Bonds2

About molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide

molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide (PubChem CID 143214195) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide.

Molecular Properties

Compound Namemolecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide
PubChem CID143214195
Molecular FormulaC12H12N2O2
Molecular Weight216.24 g/mol
Exact Mass216.09
IUPAC Namemolecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide
SMILESNC(=O)c1ccc(-n2ccccc2=O)cc1.[H][H]
InChIInChI=1S/C12H10N2O2.H2/c13-12(16)9-4-6-10(7-5-9)14-8-2-1-3-11(14)15;/h1-8H,(H2,13,16);1H
InChIKeyQVFUGUNIJHWPRC-UHFFFAOYSA-N
XLogP1.18
TPSA65.09 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide?
The IUPAC name of molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide (CID 143214195) is molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide.
What is the SMILES notation for molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide?
The canonical SMILES for molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide is NC(=O)c1ccc(-n2ccccc2=O)cc1.[H][H].
What is the InChIKey of molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide?
The InChIKey is QVFUGUNIJHWPRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2.H2/c13-12(16)9-4-6-10(7-5-9)14-8-2-1-3-11(14)15;/h1-8H,(H2,13,16);1H.
What are the key properties of molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide?
molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide has a molecular weight of 216.24 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;4-(2-oxo-1-pyridinyl)benzamide is sourced from PubChem (CID 143214195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).