C20H16N4O4 — CID 174815497
4-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]benzene-1,2-dicarboxamide (PubChem CID 174815497) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is 4-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]benzene-1,2-dicarboxamide.
| Compound Name | 4-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 174815497 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]benzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2ccc(-n3ccccc3=O)cc2)cc1C(N)=O |
| InChI | InChI=1S/C20H16N4O4/c21-18(26)15-9-6-13(11-16(15)19(22)27)23-20(28)12-4-7-14(8-5-12)24-10-2-1-3-17(24)25/h1-11H,(H2,21,26)(H2,22,27)(H,23,28) |
| InChIKey | SOIUEXBCBGETBE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 137.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |