C25H24ClN3O3 — CID 142943661
4-chloro-2-methyl-N-[(1R)-2-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]cyclopentyl]benzamide (PubChem CID 142943661) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is 4-chloro-2-methyl-N-[(1R)-2-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]cyclopentyl]benzamide.
| Compound Name | 4-chloro-2-methyl-N-[(1R)-2-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]cyclopentyl]benzamide |
|---|---|
| PubChem CID | 142943661 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 4-chloro-2-methyl-N-[(1R)-2-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]cyclopentyl]benzamide |
| SMILES | Cc1cc(Cl)ccc1C(=O)N[C@@H]1CCCC1NC(=O)c1ccc(-n2ccccc2=O)cc1 |
| InChI | InChI=1S/C25H24ClN3O3/c1-16-15-18(26)10-13-20(16)25(32)28-22-6-4-5-21(22)27-24(31)17-8-11-19(12-9-17)29-14-3-2-7-23(29)30/h2-3,7-15,21-22H,4-6H2,1H3,(H,27,31)(H,28,32)/t21?,22-/m1/s1 |
| InChIKey | BJQSEMNGLNBYSA-FOIFJWKZSA-N |
| XLogP | 3.88 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |