C18H18FN3O3 — CID 18453005
N-(2-carbamoylcyclopentyl)-2-fluoro-4-(2-oxo-1-pyridinyl)benzamide (PubChem CID 18453005) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is N-(2-carbamoylcyclopentyl)-2-fluoro-4-(2-oxo-1-pyridinyl)benzamide.
| Compound Name | N-(2-carbamoylcyclopentyl)-2-fluoro-4-(2-oxo-1-pyridinyl)benzamide |
|---|---|
| PubChem CID | 18453005 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-(2-carbamoylcyclopentyl)-2-fluoro-4-(2-oxo-1-pyridinyl)benzamide |
| SMILES | NC(=O)C1CCCC1NC(=O)c1ccc(-n2ccccc2=O)cc1F |
| InChI | InChI=1S/C18H18FN3O3/c19-14-10-11(22-9-2-1-6-16(22)23)7-8-12(14)18(25)21-15-5-3-4-13(15)17(20)24/h1-2,6-10,13,15H,3-5H2,(H2,20,24)(H,21,25) |
| InChIKey | ZCRVWHUKJGHMLH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |