C26H31N3O3 — CID 142943441
cyclopentane;3,4-dimethylbenzamide;4-(2-oxo-1-pyridinyl)benzamide (PubChem CID 142943441) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is cyclopentane;3,4-dimethylbenzamide;4-(2-oxo-1-pyridinyl)benzamide.
| Compound Name | cyclopentane;3,4-dimethylbenzamide;4-(2-oxo-1-pyridinyl)benzamide |
|---|---|
| PubChem CID | 142943441 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | cyclopentane;3,4-dimethylbenzamide;4-(2-oxo-1-pyridinyl)benzamide |
| SMILES | C1CCCC1.Cc1ccc(C(N)=O)cc1C.NC(=O)c1ccc(-n2ccccc2=O)cc1 |
| InChI | InChI=1S/C12H10N2O2.C9H11NO.C5H10/c13-12(16)9-4-6-10(7-5-9)14-8-2-1-3-11(14)15;1-6-3-4-8(9(10)11)5-7(6)2;1-2-4-5-3-1/h1-8H,(H2,13,16);3-5H,1-2H3,(H2,10,11);1-5H2 |
| InChIKey | HIDQIJPOJRCCDN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |