C25H38N2O2 — CID 173143847
[(2S)-1-[2-[4-[(3aR,4R,6aS)-2-(oxan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]phenyl]ethyl]pyrrolidin-2-yl]methanol (PubChem CID 173143847) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is [(2S)-1-[2-[4-[(3aR,4R,6aS)-2-(oxan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]phenyl]ethyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[2-[4-[(3aR,4R,6aS)-2-(oxan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]phenyl]ethyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 173143847 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | [(2S)-1-[2-[4-[(3aR,4R,6aS)-2-(oxan-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]phenyl]ethyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1CCc1ccc([C@@H]2CC[C@@H]3CN(C4CCCCO4)C[C@@H]32)cc1 |
| InChI | InChI=1S/C25H38N2O2/c28-18-22-4-3-13-26(22)14-12-19-6-8-20(9-7-19)23-11-10-21-16-27(17-24(21)23)25-5-1-2-15-29-25/h6-9,21-25,28H,1-5,10-18H2/t21-,22+,23+,24+,25?/m1/s1 |
| InChIKey | YULFDOAHQMAFDU-OFWFYPOHSA-N |
| XLogP | 3.64 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |