C25H32N4O — CID 69113796
[4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-pyrazin-2-ylmethanone (PubChem CID 69113796) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is [4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-pyrazin-2-ylmethanone.
| Compound Name | [4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 69113796 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-pyrazin-2-ylmethanone |
| SMILES | CC1CCCN1CCc1ccc(C2CCC3CN(C(=O)c4cnccn4)CC32)cc1 |
| InChI | InChI=1S/C25H32N4O/c1-18-3-2-13-28(18)14-10-19-4-6-20(7-5-19)22-9-8-21-16-29(17-23(21)22)25(30)24-15-26-11-12-27-24/h4-7,11-12,15,18,21-23H,2-3,8-10,13-14,16-17H2,1H3 |
| InChIKey | DATZZPIZXBCNJR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |