C22H26FN3O — CID 95795699
[(5aS,8aS)-1-[2-(4-fluorophenyl)ethyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-pyridin-2-ylmethanone (PubChem CID 95795699) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is [(5aS,8aS)-1-[2-(4-fluorophenyl)ethyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-pyridin-2-ylmethanone.
| Compound Name | [(5aS,8aS)-1-[2-(4-fluorophenyl)ethyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 95795699 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [(5aS,8aS)-1-[2-(4-fluorophenyl)ethyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1C[C@@H]2CCCCN(CCc3ccc(F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C22H26FN3O/c23-19-9-7-17(8-10-19)11-14-25-13-4-2-5-18-15-26(16-21(18)25)22(27)20-6-1-3-12-24-20/h1,3,6-10,12,18,21H,2,4-5,11,13-16H2/t18-,21+/m0/s1 |
| InChIKey | PZBLJRJCBZNYMF-GHTZIAJQSA-N |
| XLogP | 3.39 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |