C18H20F2N2 — CID 29084179
2-[(2R)-1-[2-(3,5-difluorophenyl)ethyl]piperidin-2-yl]pyridine (PubChem CID 29084179) has the molecular formula C18H20F2N2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[(2R)-1-[2-(3,5-difluorophenyl)ethyl]piperidin-2-yl]pyridine.
| Compound Name | 2-[(2R)-1-[2-(3,5-difluorophenyl)ethyl]piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 29084179 |
| Molecular Formula | C18H20F2N2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[(2R)-1-[2-(3,5-difluorophenyl)ethyl]piperidin-2-yl]pyridine |
| SMILES | Fc1cc(F)cc(CCN2CCCC[C@@H]2c2ccccn2)c1 |
| InChI | InChI=1S/C18H20F2N2/c19-15-11-14(12-16(20)13-15)7-10-22-9-4-2-6-18(22)17-5-1-3-8-21-17/h1,3,5,8,11-13,18H,2,4,6-7,9-10H2/t18-/m1/s1 |
| InChIKey | GFGOBANQJINKTG-GOSISDBHSA-N |
| XLogP | 4.13 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |