C10H9BrFNO — CID 173143956
2-bromo-3-(4-fluorophenyl)-5-methyl-5H-1,2-oxazole (PubChem CID 173143956) has the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. Its IUPAC name is 2-bromo-3-(4-fluorophenyl)-5-methyl-5H-1,2-oxazole.
| Compound Name | 2-bromo-3-(4-fluorophenyl)-5-methyl-5H-1,2-oxazole |
|---|---|
| PubChem CID | 173143956 |
| Molecular Formula | C10H9BrFNO |
| Molecular Weight | 258.09 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-bromo-3-(4-fluorophenyl)-5-methyl-5H-1,2-oxazole |
| SMILES | CC1C=C(c2ccc(F)cc2)N(Br)O1 |
| InChI | InChI=1S/C10H9BrFNO/c1-7-6-10(13(11)14-7)8-2-4-9(12)5-3-8/h2-7H,1H3 |
| InChIKey | HRXFHGCOWPVHAE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.09 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|