C10H9ClFNO — CID 57128721
5-(chloromethyl)-3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 57128721) has the molecular formula C10H9ClFNO and a molecular weight of 213.64 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(chloromethyl)-3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 57128721 |
| Molecular Formula | C10H9ClFNO |
| Molecular Weight | 213.64 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 5-(chloromethyl)-3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | Fc1ccc(C2=CC(CCl)ON2)cc1 |
| InChI | InChI=1S/C10H9ClFNO/c11-6-9-5-10(13-14-9)7-1-3-8(12)4-2-7/h1-5,9,13H,6H2 |
| InChIKey | PDJGTDYRLXTMTE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.64 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|