C11H10FNO2 — CID 91239341
3-(4-fluorophenyl)-5-(methoxymethylidene)-2H-1,2-oxazole (PubChem CID 91239341) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-(methoxymethylidene)-2H-1,2-oxazole.
| Compound Name | 3-(4-fluorophenyl)-5-(methoxymethylidene)-2H-1,2-oxazole |
|---|---|
| PubChem CID | 91239341 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-(4-fluorophenyl)-5-(methoxymethylidene)-2H-1,2-oxazole |
| SMILES | COC=C1C=C(c2ccc(F)cc2)NO1 |
| InChI | InChI=1S/C11H10FNO2/c1-14-7-10-6-11(13-15-10)8-2-4-9(12)5-3-8/h2-7,13H,1H3 |
| InChIKey | RQTSWOMNBGITJS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|