About 1-dodecylisoquinoline;hydroiodide
1-dodecylisoquinoline;hydroiodide (PubChem CID 173144441) has the molecular formula C21H32IN
and a molecular weight of 425.40 g/mol. Its IUPAC name is 1-dodecylisoquinoline;hydroiodide.
Molecular Properties
| Compound Name | 1-dodecylisoquinoline;hydroiodide |
| PubChem CID | 173144441 |
| Molecular Formula | C21H32IN |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1-dodecylisoquinoline;hydroiodide |
| SMILES | CCCCCCCCCCCCc1nccc2ccccc12.I |
| InChI | InChI=1S/C21H31N.HI/c1-2-3-4-5-6-7-8-9-10-11-16-21-20-15-13-12-14-19(20)17-18-22-21;/h12-15,17-18H,2-11,16H2,1H3;1H |
| InChIKey | UNGQKWYFNCVIFJ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecylisoquinoline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecylisoquinoline;hydroiodide?
The IUPAC name of 1-dodecylisoquinoline;hydroiodide (CID 173144441) is 1-dodecylisoquinoline;hydroiodide.
What is the SMILES notation for 1-dodecylisoquinoline;hydroiodide?
The canonical SMILES for 1-dodecylisoquinoline;hydroiodide is CCCCCCCCCCCCc1nccc2ccccc12.I.
What is the InChIKey of 1-dodecylisoquinoline;hydroiodide?
The InChIKey is UNGQKWYFNCVIFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N.HI/c1-2-3-4-5-6-7-8-9-10-11-16-21-20-15-13-12-14-19(20)17-18-22-21;/h12-15,17-18H,2-11,16H2,1H3;1H.
What are the key properties of 1-dodecylisoquinoline;hydroiodide?
1-dodecylisoquinoline;hydroiodide has a molecular weight of 425.40 g/mol, XLogP of 7.32, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecylisoquinoline;hydroiodide is sourced from PubChem (CID 173144441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).