About lithium;silicic acid;trihydroxy(oxido)silane
lithium;silicic acid;trihydroxy(oxido)silane (PubChem CID 173146526) has the molecular formula H7LiO8Si2
and a molecular weight of 198.16 g/mol. Its IUPAC name is lithium;silicic acid;trihydroxy(oxido)silane.
Molecular Properties
| Compound Name | lithium;silicic acid;trihydroxy(oxido)silane |
| PubChem CID | 173146526 |
| Molecular Formula | H7LiO8Si2 |
| Molecular Weight | 198.16 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | lithium;silicic acid;trihydroxy(oxido)silane |
| SMILES | O[Si](O)(O)O.[Li+].[O-][Si](O)(O)O |
| InChI | InChI=1S/Li.H4O4Si.H3O4Si/c;2*1-5(2,3)4/h;1-4H;1-3H/q+1;;-1 |
| InChIKey | QHJOTUVTLCXOQV-UHFFFAOYSA-N |
| XLogP | -8.85 |
| TPSA | 164.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 198.16 |
| LogP ≤ 5 | -8.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;silicic acid;trihydroxy(oxido)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;silicic acid;trihydroxy(oxido)silane?
The IUPAC name of lithium;silicic acid;trihydroxy(oxido)silane (CID 173146526) is lithium;silicic acid;trihydroxy(oxido)silane.
What is the SMILES notation for lithium;silicic acid;trihydroxy(oxido)silane?
The canonical SMILES for lithium;silicic acid;trihydroxy(oxido)silane is O[Si](O)(O)O.[Li+].[O-][Si](O)(O)O.
What is the InChIKey of lithium;silicic acid;trihydroxy(oxido)silane?
The InChIKey is QHJOTUVTLCXOQV-UHFFFAOYSA-N. The full InChI is InChI=1S/Li.H4O4Si.H3O4Si/c;2*1-5(2,3)4/h;1-4H;1-3H/q+1;;-1.
What are the key properties of lithium;silicic acid;trihydroxy(oxido)silane?
lithium;silicic acid;trihydroxy(oxido)silane has a molecular weight of 198.16 g/mol, XLogP of -8.85, 0 rotatable bonds, 7 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;silicic acid;trihydroxy(oxido)silane is sourced from PubChem (CID 173146526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).