About lithium;dihydroxy(dioxido)silane;oxostibanylium
lithium;dihydroxy(dioxido)silane;oxostibanylium (PubChem CID 173299735) has the molecular formula H2LiO5SbSi
and a molecular weight of 238.80 g/mol. Its IUPAC name is lithium;dihydroxy(dioxido)silane;oxostibanylium.
Molecular Properties
| Compound Name | lithium;dihydroxy(dioxido)silane;oxostibanylium |
| PubChem CID | 173299735 |
| Molecular Formula | H2LiO5SbSi |
| Molecular Weight | 238.80 g/mol |
| Exact Mass | 237.89 |
| IUPAC Name | lithium;dihydroxy(dioxido)silane;oxostibanylium |
| SMILES | O=[Sb+].[Li+].[O-][Si]([O-])(O)O |
| InChI | InChI=1S/Li.H2O4Si.O.Sb/c;1-5(2,3)4;;/h;1-2H;;/q+1;-2;;+1 |
| InChIKey | KACZRJCABYFELF-UHFFFAOYSA-N |
| XLogP | -7.37 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.80 |
| LogP ≤ 5 | -7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;dihydroxy(dioxido)silane;oxostibanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;dihydroxy(dioxido)silane;oxostibanylium?
The IUPAC name of lithium;dihydroxy(dioxido)silane;oxostibanylium (CID 173299735) is lithium;dihydroxy(dioxido)silane;oxostibanylium.
What is the SMILES notation for lithium;dihydroxy(dioxido)silane;oxostibanylium?
The canonical SMILES for lithium;dihydroxy(dioxido)silane;oxostibanylium is O=[Sb+].[Li+].[O-][Si]([O-])(O)O.
What is the InChIKey of lithium;dihydroxy(dioxido)silane;oxostibanylium?
The InChIKey is KACZRJCABYFELF-UHFFFAOYSA-N. The full InChI is InChI=1S/Li.H2O4Si.O.Sb/c;1-5(2,3)4;;/h;1-2H;;/q+1;-2;;+1.
What are the key properties of lithium;dihydroxy(dioxido)silane;oxostibanylium?
lithium;dihydroxy(dioxido)silane;oxostibanylium has a molecular weight of 238.80 g/mol, XLogP of -7.37, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;dihydroxy(dioxido)silane;oxostibanylium is sourced from PubChem (CID 173299735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).