About magnesium;dihydroxy(dioxido)silane;sulfuric acid
magnesium;dihydroxy(dioxido)silane;sulfuric acid (PubChem CID 173040937) has the molecular formula H4MgO8SSi
and a molecular weight of 216.48 g/mol. Its IUPAC name is magnesium;dihydroxy(dioxido)silane;sulfuric acid.
Molecular Properties
| Compound Name | magnesium;dihydroxy(dioxido)silane;sulfuric acid |
| PubChem CID | 173040937 |
| Molecular Formula | H4MgO8SSi |
| Molecular Weight | 216.48 g/mol |
| Exact Mass | 215.92 |
| IUPAC Name | magnesium;dihydroxy(dioxido)silane;sulfuric acid |
| SMILES | O=S(=O)(O)O.[Mg+2].[O-][Si]([O-])(O)O |
| InChI | InChI=1S/Mg.H2O4S.H2O4Si/c;2*1-5(2,3)4/h;(H2,1,2,3,4);1-2H/q+2;;-2 |
| InChIKey | DEJFIZITGSLCQO-UHFFFAOYSA-N |
| XLogP | -4.91 |
| TPSA | 161.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.48 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze magnesium;dihydroxy(dioxido)silane;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;dihydroxy(dioxido)silane;sulfuric acid?
The IUPAC name of magnesium;dihydroxy(dioxido)silane;sulfuric acid (CID 173040937) is magnesium;dihydroxy(dioxido)silane;sulfuric acid.
What is the SMILES notation for magnesium;dihydroxy(dioxido)silane;sulfuric acid?
The canonical SMILES for magnesium;dihydroxy(dioxido)silane;sulfuric acid is O=S(=O)(O)O.[Mg+2].[O-][Si]([O-])(O)O.
What is the InChIKey of magnesium;dihydroxy(dioxido)silane;sulfuric acid?
The InChIKey is DEJFIZITGSLCQO-UHFFFAOYSA-N. The full InChI is InChI=1S/Mg.H2O4S.H2O4Si/c;2*1-5(2,3)4/h;(H2,1,2,3,4);1-2H/q+2;;-2.
What are the key properties of magnesium;dihydroxy(dioxido)silane;sulfuric acid?
magnesium;dihydroxy(dioxido)silane;sulfuric acid has a molecular weight of 216.48 g/mol, XLogP of -4.91, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;dihydroxy(dioxido)silane;sulfuric acid is sourced from PubChem (CID 173040937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).