About magnesium;sulfuric acid;carbonate
magnesium;sulfuric acid;carbonate (PubChem CID 174916086) has the molecular formula CH2MgO7S
and a molecular weight of 182.39 g/mol. Its IUPAC name is magnesium;sulfuric acid;carbonate.
Molecular Properties
| Compound Name | magnesium;sulfuric acid;carbonate |
| PubChem CID | 174916086 |
| Molecular Formula | CH2MgO7S |
| Molecular Weight | 182.39 g/mol |
| Exact Mass | 181.94 |
| IUPAC Name | magnesium;sulfuric acid;carbonate |
| SMILES | O=C([O-])[O-].O=S(=O)(O)O.[Mg+2] |
| InChI | InChI=1S/CH2O3.Mg.H2O4S/c2-1(3)4;;1-5(2,3)4/h(H2,2,3,4);;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | QZORYBJRCCTQBP-UHFFFAOYSA-L |
| XLogP | -3.48 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.39 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze magnesium;sulfuric acid;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;sulfuric acid;carbonate?
The IUPAC name of magnesium;sulfuric acid;carbonate (CID 174916086) is magnesium;sulfuric acid;carbonate.
What is the SMILES notation for magnesium;sulfuric acid;carbonate?
The canonical SMILES for magnesium;sulfuric acid;carbonate is O=C([O-])[O-].O=S(=O)(O)O.[Mg+2].
What is the InChIKey of magnesium;sulfuric acid;carbonate?
The InChIKey is QZORYBJRCCTQBP-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Mg.H2O4S/c2-1(3)4;;1-5(2,3)4/h(H2,2,3,4);;(H2,1,2,3,4)/q;+2;/p-2.
What are the key properties of magnesium;sulfuric acid;carbonate?
magnesium;sulfuric acid;carbonate has a molecular weight of 182.39 g/mol, XLogP of -3.48, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;sulfuric acid;carbonate is sourced from PubChem (CID 174916086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).